C21H20ClF3N2O2 — CID 108561767
N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide (PubChem CID 108561767) has the molecular formula C21H20ClF3N2O2 and a molecular weight of 424.85 g/mol. Its IUPAC name is N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 108561767 |
| Molecular Formula | C21H20ClF3N2O2 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCN(C(=O)Cc2ccc(Cl)cc2)CC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H20ClF3N2O2/c22-15-7-5-14(6-8-15)13-19(28)27-11-9-16(10-12-27)26-20(29)17-3-1-2-4-18(17)21(23,24)25/h1-8,16H,9-13H2,(H,26,29) |
| InChIKey | OUVMKKAHIQRBNC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |