C19H16F2N2O — CID 125465048
2-cyano-N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopentyl]benzamide (PubChem CID 125465048) has the molecular formula C19H16F2N2O and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-cyano-N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopentyl]benzamide.
| Compound Name | 2-cyano-N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 125465048 |
| Molecular Formula | C19H16F2N2O |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-cyano-N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopentyl]benzamide |
| SMILES | N#Cc1ccccc1C(=O)N[C@@H]1CCC[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H16F2N2O/c20-16-9-8-12(10-17(16)21)14-6-3-7-18(14)23-19(24)15-5-2-1-4-13(15)11-22/h1-2,4-5,8-10,14,18H,3,6-7H2,(H,23,24)/t14-,18+/m0/s1 |
| InChIKey | RBHONCITIHQLFN-KBXCAEBGSA-N |
| XLogP | 3.90 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |