C13H17FN2O — CID 63279485
2-amino-3-fluoro-N-(2-methylcyclopentyl)benzamide (PubChem CID 63279485) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-amino-3-fluoro-N-(2-methylcyclopentyl)benzamide.
| Compound Name | 2-amino-3-fluoro-N-(2-methylcyclopentyl)benzamide |
|---|---|
| PubChem CID | 63279485 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-amino-3-fluoro-N-(2-methylcyclopentyl)benzamide |
| SMILES | CC1CCCC1NC(=O)c1cccc(F)c1N |
| InChI | InChI=1S/C13H17FN2O/c1-8-4-2-7-11(8)16-13(17)9-5-3-6-10(14)12(9)15/h3,5-6,8,11H,2,4,7,15H2,1H3,(H,16,17) |
| InChIKey | WCQOOQFZQKMEOL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|