C18H14N2O3S2 — CID 24683485
N-[2-(thieno[3,2-b][1]benzothiole-2-carbonylamino)ethyl]furan-2-carboxamide (PubChem CID 24683485) has the molecular formula C18H14N2O3S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[2-(thieno[3,2-b][1]benzothiole-2-carbonylamino)ethyl]furan-2-carboxamide.
| Compound Name | N-[2-(thieno[3,2-b][1]benzothiole-2-carbonylamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24683485 |
| Molecular Formula | C18H14N2O3S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-[2-(thieno[3,2-b][1]benzothiole-2-carbonylamino)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cc2sc3ccccc3c2s1)c1ccco1 |
| InChI | InChI=1S/C18H14N2O3S2/c21-17(12-5-3-9-23-12)19-7-8-20-18(22)15-10-14-16(25-15)11-4-1-2-6-13(11)24-14/h1-6,9-10H,7-8H2,(H,19,21)(H,20,22) |
| InChIKey | NUNMCJQBYVAMHO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|