C22H22N2O2S — CID 55958337
N-[4-(cyclopentylcarbamoyl)phenyl]-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 55958337) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[4-(cyclopentylcarbamoyl)phenyl]-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-(cyclopentylcarbamoyl)phenyl]-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55958337 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[4-(cyclopentylcarbamoyl)phenyl]-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(C(=O)NC3CCCC3)cc2)sc2ccccc12 |
| InChI | InChI=1S/C22H22N2O2S/c1-14-18-8-4-5-9-19(18)27-20(14)22(26)24-17-12-10-15(11-13-17)21(25)23-16-6-2-3-7-16/h4-5,8-13,16H,2-3,6-7H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | HCYSVJPQIFEFRD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |