C30H29Cl2NO3S2 — CID 4996389
propyl 4-(4-cyclohexylphenyl)-2-[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]-5-methylthiophene-3-carboxylate (PubChem CID 4996389) has the molecular formula C30H29Cl2NO3S2 and a molecular weight of 586.61 g/mol. Its IUPAC name is propyl 4-(4-cyclohexylphenyl)-2-[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]-5-methylthiophene-3-carboxylate.
| Compound Name | propyl 4-(4-cyclohexylphenyl)-2-[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4996389 |
| Molecular Formula | C30H29Cl2NO3S2 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 585.10 |
| IUPAC Name | propyl 4-(4-cyclohexylphenyl)-2-[(3,6-dichloro-1-benzothiophene-2-carbonyl)amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)c2sc3cc(Cl)ccc3c2Cl)sc(C)c1-c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H29Cl2NO3S2/c1-3-15-36-30(35)25-24(20-11-9-19(10-12-20)18-7-5-4-6-8-18)17(2)37-29(25)33-28(34)27-26(32)22-14-13-21(31)16-23(22)38-27/h9-14,16,18H,3-8,15H2,1-2H3,(H,33,34) |
| InChIKey | FZEONIWEXOVTQZ-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|