C30H20Cl2N2O4S — CID 6265408
[2-[(Z)-[[4-[(4-chlorophenoxy)methyl]benzoyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 6265408) has the molecular formula C30H20Cl2N2O4S and a molecular weight of 575.47 g/mol. Its IUPAC name is [2-[(Z)-[[4-[(4-chlorophenoxy)methyl]benzoyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[(Z)-[[4-[(4-chlorophenoxy)methyl]benzoyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6265408 |
| Molecular Formula | C30H20Cl2N2O4S |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 574.05 |
| IUPAC Name | [2-[(Z)-[[4-[(4-chlorophenoxy)methyl]benzoyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(N/N=C\c1ccccc1OC(=O)c1sc2ccccc2c1Cl)c1ccc(COc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H20Cl2N2O4S/c31-22-13-15-23(16-14-22)37-18-19-9-11-20(12-10-19)29(35)34-33-17-21-5-1-3-7-25(21)38-30(36)28-27(32)24-6-2-4-8-26(24)39-28/h1-17H,18H2,(H,34,35)/b33-17- |
| InChIKey | NGMHXJYUKQBUNJ-FZPRHHONSA-N |
| XLogP | 7.77 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|