C29H26ClN3O5S — CID 6031521
[2-[(Z)-[[2-[(4-butoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 6031521) has the molecular formula C29H26ClN3O5S and a molecular weight of 564.06 g/mol. Its IUPAC name is [2-[(Z)-[[2-[(4-butoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[(Z)-[[2-[(4-butoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6031521 |
| Molecular Formula | C29H26ClN3O5S |
| Molecular Weight | 564.06 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | [2-[(Z)-[[2-[(4-butoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)N/N=C\c2ccccc2OC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C29H26ClN3O5S/c1-2-3-16-37-21-14-12-19(13-15-21)28(35)31-18-25(34)33-32-17-20-8-4-6-10-23(20)38-29(36)27-26(30)22-9-5-7-11-24(22)39-27/h4-15,17H,2-3,16,18H2,1H3,(H,31,35)(H,33,34)/b32-17- |
| InChIKey | WWLPZNMEIOEZNK-KYHGBAKBSA-N |
| XLogP | 5.83 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.06 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|