C25H16Cl3N3O4S — CID 6265286
[2-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 6265286) has the molecular formula C25H16Cl3N3O4S and a molecular weight of 560.85 g/mol. Its IUPAC name is [2-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6265286 |
| Molecular Formula | C25H16Cl3N3O4S |
| Molecular Weight | 560.85 g/mol |
| Exact Mass | 558.99 |
| IUPAC Name | [2-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)N/N=C\c1ccccc1OC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C25H16Cl3N3O4S/c26-17-10-9-14(11-18(17)27)24(33)29-13-21(32)31-30-12-15-5-1-3-7-19(15)35-25(34)23-22(28)16-6-2-4-8-20(16)36-23/h1-12H,13H2,(H,29,33)(H,31,32)/b30-12- |
| InChIKey | XIKAKJWAHMIWJW-FTCYSYDXSA-N |
| XLogP | 5.96 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.85 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|