C23H13Cl3N2O3S — CID 6266783
[2-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 6266783) has the molecular formula C23H13Cl3N2O3S and a molecular weight of 503.79 g/mol. Its IUPAC name is [2-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6266783 |
| Molecular Formula | C23H13Cl3N2O3S |
| Molecular Weight | 503.79 g/mol |
| Exact Mass | 501.97 |
| IUPAC Name | [2-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(N/N=C\c1ccccc1OC(=O)c1sc2ccccc2c1Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H13Cl3N2O3S/c24-16-10-9-13(11-17(16)25)22(29)28-27-12-14-5-1-3-7-18(14)31-23(30)21-20(26)15-6-2-4-8-19(15)32-21/h1-12H,(H,28,29)/b27-12- |
| InChIKey | VITIYBBQIONQKU-PPDIBHTLSA-N |
| XLogP | 6.84 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.79 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|