C26H21ClN2O6S — CID 3270219
[2-[[(3,4,5-trimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 3270219) has the molecular formula C26H21ClN2O6S and a molecular weight of 524.98 g/mol. Its IUPAC name is [2-[[(3,4,5-trimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[[(3,4,5-trimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 3270219 |
| Molecular Formula | C26H21ClN2O6S |
| Molecular Weight | 524.98 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | [2-[[(3,4,5-trimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | COc1cc(C(=O)NN=Cc2ccccc2OC(=O)c2sc3ccccc3c2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C26H21ClN2O6S/c1-32-19-12-16(13-20(33-2)23(19)34-3)25(30)29-28-14-15-8-4-6-10-18(15)35-26(31)24-22(27)17-9-5-7-11-21(17)36-24/h4-14H,1-3H3,(H,29,30) |
| InChIKey | SDYKIECBNIHLKS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.98 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|