C25H19BrClN3O3S — CID 6106414
N-[2-[(2Z)-2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 6106414) has the molecular formula C25H19BrClN3O3S and a molecular weight of 556.87 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-[(2Z)-2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6106414 |
| Molecular Formula | C25H19BrClN3O3S |
| Molecular Weight | 556.87 g/mol |
| Exact Mass | 555.00 |
| IUPAC Name | N-[2-[(2Z)-2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1sc2ccccc2c1Cl)N/N=C\c1ccccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H19BrClN3O3S/c26-18-11-9-16(10-12-18)15-33-20-7-3-1-5-17(20)13-29-30-22(31)14-28-25(32)24-23(27)19-6-2-4-8-21(19)34-24/h1-13H,14-15H2,(H,28,32)(H,30,31)/b29-13- |
| InChIKey | NCIKFSDIQLSYAR-DBFSUHOCSA-N |
| XLogP | 5.78 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.87 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|