C23H16BrClN2O2S — CID 4612158
N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 4612158) has the molecular formula C23H16BrClN2O2S and a molecular weight of 499.82 g/mol. Its IUPAC name is N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4612158 |
| Molecular Formula | C23H16BrClN2O2S |
| Molecular Weight | 499.82 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)ccc1OCc1ccccc1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C23H16BrClN2O2S/c24-17-10-11-19(29-14-15-6-2-1-3-7-15)16(12-17)13-26-27-23(28)22-21(25)18-8-4-5-9-20(18)30-22/h1-13H,14H2,(H,27,28) |
| InChIKey | IIGGZYXONYPFRX-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.82 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|