C23H17ClN2O3S — CID 54738720
N-[2-[(4-chlorophenyl)carbamoyl]-4-methylphenyl]-3-hydroxy-1-benzothiophene-2-carboxamide (PubChem CID 54738720) has the molecular formula C23H17ClN2O3S and a molecular weight of 436.92 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)carbamoyl]-4-methylphenyl]-3-hydroxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-[(4-chlorophenyl)carbamoyl]-4-methylphenyl]-3-hydroxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 54738720 |
| Molecular Formula | C23H17ClN2O3S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | N-[2-[(4-chlorophenyl)carbamoyl]-4-methylphenyl]-3-hydroxy-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2sc3ccccc3c2O)c(C(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H17ClN2O3S/c1-13-6-11-18(17(12-13)22(28)25-15-9-7-14(24)8-10-15)26-23(29)21-20(27)16-4-2-3-5-19(16)30-21/h2-12,27H,1H3,(H,25,28)(H,26,29) |
| InChIKey | WHOUMWOPGIGSTK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|