C35H43ClN4O5 — CID 90654928
N-[2-butoxy-4-[3-(diethylamino)propoxy]phenyl]-3-[4-(4-chloro-3-methoxyphenoxy)phenyl]-1-methylpyrazole-5-carboxamide (PubChem CID 90654928) has the molecular formula C35H43ClN4O5 and a molecular weight of 635.21 g/mol. Its IUPAC name is N-[2-butoxy-4-[3-(diethylamino)propoxy]phenyl]-3-[4-(4-chloro-3-methoxyphenoxy)phenyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | N-[2-butoxy-4-[3-(diethylamino)propoxy]phenyl]-3-[4-(4-chloro-3-methoxyphenoxy)phenyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90654928 |
| Molecular Formula | C35H43ClN4O5 |
| Molecular Weight | 635.21 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | N-[2-butoxy-4-[3-(diethylamino)propoxy]phenyl]-3-[4-(4-chloro-3-methoxyphenoxy)phenyl]-1-methylpyrazole-5-carboxamide |
| SMILES | CCCCOc1cc(OCCCN(CC)CC)ccc1NC(=O)c1cc(-c2ccc(Oc3ccc(Cl)c(OC)c3)cc2)nn1C |
| InChI | InChI=1S/C35H43ClN4O5/c1-6-9-20-44-34-22-27(43-21-10-19-40(7-2)8-3)16-18-30(34)37-35(41)32-24-31(38-39(32)4)25-11-13-26(14-12-25)45-28-15-17-29(36)33(23-28)42-5/h11-18,22-24H,6-10,19-21H2,1-5H3,(H,37,41) |
| InChIKey | GKMSOZOEZOVMAK-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.21 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|