C42H52ClN3O3 — CID 59699216
3-[2-[1-butyl-6-(4-tert-butylphenoxy)benzimidazol-2-yl]-5-[2-(4-chlorophenyl)ethoxy]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 59699216) has the molecular formula C42H52ClN3O3 and a molecular weight of 682.35 g/mol. Its IUPAC name is 3-[2-[1-butyl-6-(4-tert-butylphenoxy)benzimidazol-2-yl]-5-[2-(4-chlorophenyl)ethoxy]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[2-[1-butyl-6-(4-tert-butylphenoxy)benzimidazol-2-yl]-5-[2-(4-chlorophenyl)ethoxy]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 59699216 |
| Molecular Formula | C42H52ClN3O3 |
| Molecular Weight | 682.35 g/mol |
| Exact Mass | 681.37 |
| IUPAC Name | 3-[2-[1-butyl-6-(4-tert-butylphenoxy)benzimidazol-2-yl]-5-[2-(4-chlorophenyl)ethoxy]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCCCn1c(-c2ccc(OCCc3ccc(Cl)cc3)cc2OCCCN(CC)CC)nc2ccc(Oc3ccc(C(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C42H52ClN3O3/c1-7-10-26-46-39-29-36(49-34-18-14-32(15-19-34)42(4,5)6)21-23-38(39)44-41(46)37-22-20-35(47-28-24-31-12-16-33(43)17-13-31)30-40(37)48-27-11-25-45(8-2)9-3/h12-23,29-30H,7-11,24-28H2,1-6H3 |
| InChIKey | YHMYYQMDOHHDLL-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.35 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|