C44H72N4O3 — CID 142805575
3-[3-butyl-2-[4-[(3Z,5E)-5-tert-butylhepta-3,5-dien-2-yl]oxyphenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine;ethane (PubChem CID 142805575) has the molecular formula C44H72N4O3 and a molecular weight of 705.09 g/mol. Its IUPAC name is 3-[3-butyl-2-[4-[(3Z,5E)-5-tert-butylhepta-3,5-dien-2-yl]oxyphenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine;ethane.
| Compound Name | 3-[3-butyl-2-[4-[(3Z,5E)-5-tert-butylhepta-3,5-dien-2-yl]oxyphenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 142805575 |
| Molecular Formula | C44H72N4O3 |
| Molecular Weight | 705.09 g/mol |
| Exact Mass | 704.56 |
| IUPAC Name | 3-[3-butyl-2-[4-[(3Z,5E)-5-tert-butylhepta-3,5-dien-2-yl]oxyphenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine;ethane |
| SMILES | C/C=C(\C=C/C(C)Oc1ccc(-c2nc3c(OCCCN(CC)CC)cc(OCCCN(CC)CC)cc3n2CCCC)cc1)C(C)(C)C.CC |
| InChI | InChI=1S/C42H66N4O3.C2H6/c1-11-17-28-46-38-31-37(47-29-18-26-44(13-3)14-4)32-39(48-30-19-27-45(15-5)16-6)40(38)43-41(46)34-21-24-36(25-22-34)49-33(7)20-23-35(12-2)42(8,9)10;1-2/h12,20-25,31-33H,11,13-19,26-30H2,1-10H3;1-2H3/b23-20-,35-12+; |
| InChIKey | NCWVBQFVHOEWET-JUWOPPBCSA-N |
| XLogP | 11.07 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.09 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|