C40H65N5O4 — CID 142981581
3-[3-butyl-2-[2-[2-(diethylamino)ethoxy]-4-prop-1-en-2-yloxyphenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine (PubChem CID 142981581) has the molecular formula C40H65N5O4 and a molecular weight of 679.99 g/mol. Its IUPAC name is 3-[3-butyl-2-[2-[2-(diethylamino)ethoxy]-4-prop-1-en-2-yloxyphenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine.
| Compound Name | 3-[3-butyl-2-[2-[2-(diethylamino)ethoxy]-4-prop-1-en-2-yloxyphenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 142981581 |
| Molecular Formula | C40H65N5O4 |
| Molecular Weight | 679.99 g/mol |
| Exact Mass | 679.50 |
| IUPAC Name | 3-[3-butyl-2-[2-[2-(diethylamino)ethoxy]-4-prop-1-en-2-yloxyphenyl]-7-[3-(diethylamino)propoxy]benzimidazol-5-yl]oxy-N,N-diethylpropan-1-amine |
| SMILES | C=C(C)Oc1ccc(-c2nc3c(OCCCN(CC)CC)cc(OCCCN(CC)CC)cc3n2CCCC)c(OCCN(CC)CC)c1 |
| InChI | InChI=1S/C40H65N5O4/c1-10-17-24-45-36-29-34(46-26-18-22-42(11-2)12-3)31-38(47-27-19-23-43(13-4)14-5)39(36)41-40(45)35-21-20-33(49-32(8)9)30-37(35)48-28-25-44(15-6)16-7/h20-21,29-31H,8,10-19,22-28H2,1-7,9H3 |
| InChIKey | KEKQVSJVZAJRHQ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 64.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.99 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|