C30H45N3O4 — CID 70829887
tert-butyl N-[(2R)-1-[4-[3-(diethylamino)propoxy]-N-propan-2-ylanilino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 70829887) has the molecular formula C30H45N3O4 and a molecular weight of 511.71 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[4-[3-(diethylamino)propoxy]-N-propan-2-ylanilino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[4-[3-(diethylamino)propoxy]-N-propan-2-ylanilino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70829887 |
| Molecular Formula | C30H45N3O4 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.34 |
| IUPAC Name | tert-butyl N-[(2R)-1-[4-[3-(diethylamino)propoxy]-N-propan-2-ylanilino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCN(CC)CCCOc1ccc(N(C(=O)[C@@H](Cc2ccccc2)NC(=O)OC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C30H45N3O4/c1-8-32(9-2)20-13-21-36-26-18-16-25(17-19-26)33(23(3)4)28(34)27(22-24-14-11-10-12-15-24)31-29(35)37-30(5,6)7/h10-12,14-19,23,27H,8-9,13,20-22H2,1-7H3,(H,31,35)/t27-/m1/s1 |
| InChIKey | YFMXLZVAQRJZNU-HHHXNRCGSA-N |
| XLogP | 5.67 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|