C21H17Cl2N3O2 — CID 19864797
2-[2-[3-(3,4-dichlorophenoxy)propoxy]phenyl]-3H-imidazo[4,5-c]pyridine (PubChem CID 19864797) has the molecular formula C21H17Cl2N3O2 and a molecular weight of 414.29 g/mol. Its IUPAC name is 2-[2-[3-(3,4-dichlorophenoxy)propoxy]phenyl]-3H-imidazo[4,5-c]pyridine.
| Compound Name | 2-[2-[3-(3,4-dichlorophenoxy)propoxy]phenyl]-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 19864797 |
| Molecular Formula | C21H17Cl2N3O2 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-[2-[3-(3,4-dichlorophenoxy)propoxy]phenyl]-3H-imidazo[4,5-c]pyridine |
| SMILES | Clc1ccc(OCCCOc2ccccc2-c2nc3ccncc3[nH]2)cc1Cl |
| InChI | InChI=1S/C21H17Cl2N3O2/c22-16-7-6-14(12-17(16)23)27-10-3-11-28-20-5-2-1-4-15(20)21-25-18-8-9-24-13-19(18)26-21/h1-2,4-9,12-13H,3,10-11H2,(H,25,26) |
| InChIKey | GJBDJUSYOLYIKM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|