C15H13N3O3S — CID 19821986
methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)phenyl]sulfinylacetate (PubChem CID 19821986) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)phenyl]sulfinylacetate.
| Compound Name | methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)phenyl]sulfinylacetate |
|---|---|
| PubChem CID | 19821986 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | methyl 2-[4-(3H-imidazo[4,5-c]pyridin-2-yl)phenyl]sulfinylacetate |
| SMILES | COC(=O)CS(=O)c1ccc(-c2nc3ccncc3[nH]2)cc1 |
| InChI | InChI=1S/C15H13N3O3S/c1-21-14(19)9-22(20)11-4-2-10(3-5-11)15-17-12-6-7-16-8-13(12)18-15/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | DKZBIBRGGXXSAY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |