C11H8N4O4 — CID 136903882
8-(2,4-dihydroxyphenyl)-3,7-dihydropurine-2,6-dione (PubChem CID 136903882) has the molecular formula C11H8N4O4 and a molecular weight of 260.21 g/mol. Its IUPAC name is 8-(2,4-dihydroxyphenyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(2,4-dihydroxyphenyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 136903882 |
| Molecular Formula | C11H8N4O4 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 8-(2,4-dihydroxyphenyl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(-c3ccc(O)cc3O)nc2[nH]1 |
| InChI | InChI=1S/C11H8N4O4/c16-4-1-2-5(6(17)3-4)8-12-7-9(13-8)14-11(19)15-10(7)18/h1-3,16-17H,(H3,12,13,14,15,18,19) |
| InChIKey | ZDDMIGOUAQEUMO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |