C13H10N4O4 — CID 114403014
8-(2,3-dihydro-1,4-benzodioxin-5-yl)-3,7-dihydropurine-2,6-dione (PubChem CID 114403014) has the molecular formula C13H10N4O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is 8-(2,3-dihydro-1,4-benzodioxin-5-yl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(2,3-dihydro-1,4-benzodioxin-5-yl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114403014 |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 8-(2,3-dihydro-1,4-benzodioxin-5-yl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(-c3cccc4c3OCCO4)nc2[nH]1 |
| InChI | InChI=1S/C13H10N4O4/c18-12-8-11(16-13(19)17-12)15-10(14-8)6-2-1-3-7-9(6)21-5-4-20-7/h1-3H,4-5H2,(H3,14,15,16,17,18,19) |
| InChIKey | BLBWLQHFYQPXGM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |