C12H11N5O2 — CID 114402197
8-(2-amino-3-methylphenyl)-3,7-dihydropurine-2,6-dione (PubChem CID 114402197) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 8-(2-amino-3-methylphenyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(2-amino-3-methylphenyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402197 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 8-(2-amino-3-methylphenyl)-3,7-dihydropurine-2,6-dione |
| SMILES | Cc1cccc(-c2nc3[nH]c(=O)[nH]c(=O)c3[nH]2)c1N |
| InChI | InChI=1S/C12H11N5O2/c1-5-3-2-4-6(7(5)13)9-14-8-10(15-9)16-12(19)17-11(8)18/h2-4H,13H2,1H3,(H3,14,15,16,17,18,19) |
| InChIKey | UTBVMCFTHBCLAD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|