C10H9N5O3 — CID 114402898
8-(2,4-dimethyl-1,3-oxazol-5-yl)-3,7-dihydropurine-2,6-dione (PubChem CID 114402898) has the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. Its IUPAC name is 8-(2,4-dimethyl-1,3-oxazol-5-yl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(2,4-dimethyl-1,3-oxazol-5-yl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402898 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 8-(2,4-dimethyl-1,3-oxazol-5-yl)-3,7-dihydropurine-2,6-dione |
| SMILES | Cc1nc(C)c(-c2nc3[nH]c(=O)[nH]c(=O)c3[nH]2)o1 |
| InChI | InChI=1S/C10H9N5O3/c1-3-6(18-4(2)11-3)8-12-5-7(13-8)14-10(17)15-9(5)16/h1-2H3,(H3,12,13,14,15,16,17) |
| InChIKey | QQRIPLWXESGBJB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |