C14H11FO2 — CID 104545385
4-(2,3-dihydro-1-benzofuran-5-yl)-3-fluorophenol (PubChem CID 104545385) has the molecular formula C14H11FO2 and a molecular weight of 230.24 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-5-yl)-3-fluorophenol.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-5-yl)-3-fluorophenol |
|---|---|
| PubChem CID | 104545385 |
| Molecular Formula | C14H11FO2 |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-5-yl)-3-fluorophenol |
| SMILES | Oc1ccc(-c2ccc3c(c2)CCO3)c(F)c1 |
| InChI | InChI=1S/C14H11FO2/c15-13-8-11(16)2-3-12(13)9-1-4-14-10(7-9)5-6-17-14/h1-4,7-8,16H,5-6H2 |
| InChIKey | OFEYFVCMHYYUCT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |