C13H10ClIN2O — CID 66311652
4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-5-iodo-6-methylpyrimidine (PubChem CID 66311652) has the molecular formula C13H10ClIN2O and a molecular weight of 372.59 g/mol. Its IUPAC name is 4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-5-iodo-6-methylpyrimidine.
| Compound Name | 4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-5-iodo-6-methylpyrimidine |
|---|---|
| PubChem CID | 66311652 |
| Molecular Formula | C13H10ClIN2O |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-5-iodo-6-methylpyrimidine |
| SMILES | Cc1nc(-c2ccc3c(c2)CCO3)nc(Cl)c1I |
| InChI | InChI=1S/C13H10ClIN2O/c1-7-11(15)12(14)17-13(16-7)9-2-3-10-8(6-9)4-5-18-10/h2-3,6H,4-5H2,1H3 |
| InChIKey | NBTVTCAAQFCPPN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|