C14H14IN3O — CID 66295990
2-(2,3-dihydro-1-benzofuran-5-yl)-6-ethyl-5-iodopyrimidin-4-amine (PubChem CID 66295990) has the molecular formula C14H14IN3O and a molecular weight of 367.19 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)-6-ethyl-5-iodopyrimidin-4-amine.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-6-ethyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66295990 |
| Molecular Formula | C14H14IN3O |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-6-ethyl-5-iodopyrimidin-4-amine |
| SMILES | CCc1nc(-c2ccc3c(c2)CCO3)nc(N)c1I |
| InChI | InChI=1S/C14H14IN3O/c1-2-10-12(15)13(16)18-14(17-10)9-3-4-11-8(7-9)5-6-19-11/h3-4,7H,2,5-6H2,1H3,(H2,16,17,18) |
| InChIKey | CVROIOQQUBIYEL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|