C15H15ClN2O — CID 43804058
4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-6-propylpyrimidine (PubChem CID 43804058) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is 4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-6-propylpyrimidine.
| Compound Name | 4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-6-propylpyrimidine |
|---|---|
| PubChem CID | 43804058 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-6-propylpyrimidine |
| SMILES | CCCc1cc(Cl)nc(-c2ccc3c(c2)CCO3)n1 |
| InChI | InChI=1S/C15H15ClN2O/c1-2-3-12-9-14(16)18-15(17-12)11-4-5-13-10(8-11)6-7-19-13/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | KHQBPHXZWUZCKD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |