C14H13ClN2O — CID 43804064
4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-6-ethylpyrimidine (PubChem CID 43804064) has the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. Its IUPAC name is 4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-6-ethylpyrimidine.
| Compound Name | 4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-6-ethylpyrimidine |
|---|---|
| PubChem CID | 43804064 |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 4-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)-6-ethylpyrimidine |
| SMILES | CCc1cc(Cl)nc(-c2ccc3c(c2)CCO3)n1 |
| InChI | InChI=1S/C14H13ClN2O/c1-2-11-8-13(15)17-14(16-11)10-3-4-12-9(7-10)5-6-18-12/h3-4,7-8H,2,5-6H2,1H3 |
| InChIKey | DVAKJYMHKPYOML-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |