C13H14N4O — CID 62250356
[2-(2,3-dihydro-1-benzofuran-5-yl)-6-methylpyrimidin-4-yl]hydrazine (PubChem CID 62250356) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is [2-(2,3-dihydro-1-benzofuran-5-yl)-6-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2,3-dihydro-1-benzofuran-5-yl)-6-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62250356 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [2-(2,3-dihydro-1-benzofuran-5-yl)-6-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc(NN)nc(-c2ccc3c(c2)CCO3)n1 |
| InChI | InChI=1S/C13H14N4O/c1-8-6-12(17-14)16-13(15-8)10-2-3-11-9(7-10)4-5-18-11/h2-3,6-7H,4-5,14H2,1H3,(H,15,16,17) |
| InChIKey | WBULGGGHVJBASR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|