C10H13BrClNO — CID 121231740
8-bromo-6-methoxy-1,2,3,4-tetrahydroquinoline;hydrochloride (PubChem CID 121231740) has the molecular formula C10H13BrClNO and a molecular weight of 278.58 g/mol. Its IUPAC name is 8-bromo-6-methoxy-1,2,3,4-tetrahydroquinoline;hydrochloride.
| Compound Name | 8-bromo-6-methoxy-1,2,3,4-tetrahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 121231740 |
| Molecular Formula | C10H13BrClNO |
| Molecular Weight | 278.58 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 8-bromo-6-methoxy-1,2,3,4-tetrahydroquinoline;hydrochloride |
| SMILES | COc1cc(Br)c2c(c1)CCCN2.Cl |
| InChI | InChI=1S/C10H12BrNO.ClH/c1-13-8-5-7-3-2-4-12-10(7)9(11)6-8;/h5-6,12H,2-4H2,1H3;1H |
| InChIKey | WAVCNFNKWYHKCZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|