C9H10BrNO3S — CID 14522156
(7-bromo-2,3-dihydro-1H-indol-5-yl) methanesulfonate (PubChem CID 14522156) has the molecular formula C9H10BrNO3S and a molecular weight of 292.15 g/mol. Its IUPAC name is (7-bromo-2,3-dihydro-1H-indol-5-yl) methanesulfonate.
| Compound Name | (7-bromo-2,3-dihydro-1H-indol-5-yl) methanesulfonate |
|---|---|
| PubChem CID | 14522156 |
| Molecular Formula | C9H10BrNO3S |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | (7-bromo-2,3-dihydro-1H-indol-5-yl) methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cc(Br)c2c(c1)CCN2 |
| InChI | InChI=1S/C9H10BrNO3S/c1-15(12,13)14-7-4-6-2-3-11-9(6)8(10)5-7/h4-5,11H,2-3H2,1H3 |
| InChIKey | AHZIIEDLHVSVMQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|