C9H8BrNO — CID 82391549
5-bromo-2,3-dihydro-1H-indole-7-carbaldehyde (PubChem CID 82391549) has the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. Its IUPAC name is 5-bromo-2,3-dihydro-1H-indole-7-carbaldehyde.
| Compound Name | 5-bromo-2,3-dihydro-1H-indole-7-carbaldehyde |
|---|---|
| PubChem CID | 82391549 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 5-bromo-2,3-dihydro-1H-indole-7-carbaldehyde |
| SMILES | O=Cc1cc(Br)cc2c1NCC2 |
| InChI | InChI=1S/C9H8BrNO/c10-8-3-6-1-2-11-9(6)7(4-8)5-12/h3-5,11H,1-2H2 |
| InChIKey | XNNCDWLLVWPJTJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|