C12H16BrN — CID 142307156
6-bromo-8-propyl-1,2,3,4-tetrahydroquinoline (PubChem CID 142307156) has the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. Its IUPAC name is 6-bromo-8-propyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-bromo-8-propyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 142307156 |
| Molecular Formula | C12H16BrN |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 6-bromo-8-propyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCc1cc(Br)cc2c1NCCC2 |
| InChI | InChI=1S/C12H16BrN/c1-2-4-9-7-11(13)8-10-5-3-6-14-12(9)10/h7-8,14H,2-6H2,1H3 |
| InChIKey | HUYALEXZUSMMHF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |