C19H23N — CID 142306886
6-benzyl-8-propyl-1,2,3,4-tetrahydroquinoline (PubChem CID 142306886) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 6-benzyl-8-propyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-benzyl-8-propyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 142306886 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 6-benzyl-8-propyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCc1cc(Cc2ccccc2)cc2c1NCCC2 |
| InChI | InChI=1S/C19H23N/c1-2-7-17-13-16(12-15-8-4-3-5-9-15)14-18-10-6-11-20-19(17)18/h3-5,8-9,13-14,20H,2,6-7,10-12H2,1H3 |
| InChIKey | NVTSCLYOESJRII-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |