C16H15F2N — CID 63968465
8-[(3,5-difluorophenyl)methyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 63968465) has the molecular formula C16H15F2N and a molecular weight of 259.30 g/mol. Its IUPAC name is 8-[(3,5-difluorophenyl)methyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-[(3,5-difluorophenyl)methyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 63968465 |
| Molecular Formula | C16H15F2N |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 8-[(3,5-difluorophenyl)methyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | Fc1cc(F)cc(Cc2cccc3c2NCCC3)c1 |
| InChI | InChI=1S/C16H15F2N/c17-14-8-11(9-15(18)10-14)7-13-4-1-3-12-5-2-6-19-16(12)13/h1,3-4,8-10,19H,2,5-7H2 |
| InChIKey | CQJQBRCJNBPMDV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |