C12H17NO — CID 119085826
7-propyl-1,2,3,4-tetrahydroquinolin-8-ol (PubChem CID 119085826) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 7-propyl-1,2,3,4-tetrahydroquinolin-8-ol.
| Compound Name | 7-propyl-1,2,3,4-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 119085826 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 7-propyl-1,2,3,4-tetrahydroquinolin-8-ol |
| SMILES | CCCc1ccc2c(c1O)NCCC2 |
| InChI | InChI=1S/C12H17NO/c1-2-4-10-7-6-9-5-3-8-13-11(9)12(10)14/h6-7,13-14H,2-5,8H2,1H3 |
| InChIKey | VWLMUGAOCHLQAV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|