C14H19N — CID 13184570
8-(3-methylbut-2-enyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 13184570) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 8-(3-methylbut-2-enyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-(3-methylbut-2-enyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 13184570 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 8-(3-methylbut-2-enyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC(C)=CCc1cccc2c1NCCC2 |
| InChI | InChI=1S/C14H19N/c1-11(2)8-9-13-6-3-5-12-7-4-10-15-14(12)13/h3,5-6,8,15H,4,7,9-10H2,1-2H3 |
| InChIKey | UUIUTTCSSZIMEP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|