C18H21NO3 — CID 90914903
7-[methoxy-(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroquinolin-8-ol (PubChem CID 90914903) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 7-[methoxy-(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroquinolin-8-ol.
| Compound Name | 7-[methoxy-(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 90914903 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 7-[methoxy-(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroquinolin-8-ol |
| SMILES | COc1ccc(C(OC)c2ccc3c(c2O)NCCC3)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-21-14-8-5-13(6-9-14)18(22-2)15-10-7-12-4-3-11-19-16(12)17(15)20/h5-10,18-20H,3-4,11H2,1-2H3 |
| InChIKey | ILYUDFMIBOYUTE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|