C14H15ClF2N2O — CID 135471423
(3Z)-1-chloro-1,1-difluoro-N-(4-methoxyphenyl)-3-pyrrolidin-2-ylidenepropan-2-imine (PubChem CID 135471423) has the molecular formula C14H15ClF2N2O and a molecular weight of 300.74 g/mol. Its IUPAC name is (3Z)-1-chloro-1,1-difluoro-N-(4-methoxyphenyl)-3-pyrrolidin-2-ylidenepropan-2-imine.
| Compound Name | (3Z)-1-chloro-1,1-difluoro-N-(4-methoxyphenyl)-3-pyrrolidin-2-ylidenepropan-2-imine |
|---|---|
| PubChem CID | 135471423 |
| Molecular Formula | C14H15ClF2N2O |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (3Z)-1-chloro-1,1-difluoro-N-(4-methoxyphenyl)-3-pyrrolidin-2-ylidenepropan-2-imine |
| SMILES | COc1ccc(/N=C(/C=C2/CCCN2)C(F)(F)Cl)cc1 |
| InChI | InChI=1S/C14H15ClF2N2O/c1-20-12-6-4-10(5-7-12)19-13(14(15,16)17)9-11-3-2-8-18-11/h4-7,9,18H,2-3,8H2,1H3/b11-9-,19-13- |
| InChIKey | FTJCXNDVSLMKFO-NHJGUPFESA-N |
| XLogP | 3.87 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|