C9H9BrFN — CID 16791217
6-bromo-8-fluoro-1,2,3,4-tetrahydroquinoline (PubChem CID 16791217) has the molecular formula C9H9BrFN and a molecular weight of 230.08 g/mol. Its IUPAC name is 6-bromo-8-fluoro-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-bromo-8-fluoro-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 16791217 |
| Molecular Formula | C9H9BrFN |
| Molecular Weight | 230.08 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 6-bromo-8-fluoro-1,2,3,4-tetrahydroquinoline |
| SMILES | Fc1cc(Br)cc2c1NCCC2 |
| InChI | InChI=1S/C9H9BrFN/c10-7-4-6-2-1-3-12-9(6)8(11)5-7/h4-5,12H,1-3H2 |
| InChIKey | RHPZZEKDQMMXIN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.08 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |