C8H8ClF2N — CID 71303632
5,7-difluoro-2,3-dihydro-1H-indole;hydrochloride (PubChem CID 71303632) has the molecular formula C8H8ClF2N and a molecular weight of 191.61 g/mol. Its IUPAC name is 5,7-difluoro-2,3-dihydro-1H-indole;hydrochloride.
| Compound Name | 5,7-difluoro-2,3-dihydro-1H-indole;hydrochloride |
|---|---|
| PubChem CID | 71303632 |
| Molecular Formula | C8H8ClF2N |
| Molecular Weight | 191.61 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 5,7-difluoro-2,3-dihydro-1H-indole;hydrochloride |
| SMILES | Cl.Fc1cc(F)c2c(c1)CCN2 |
| InChI | InChI=1S/C8H7F2N.ClH/c9-6-3-5-1-2-11-8(5)7(10)4-6;/h3-4,11H,1-2H2;1H |
| InChIKey | JDXCHUPNYXAFAD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |