About 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine
7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine (PubChem CID 82393363) has the molecular formula C7H8BrNS
and a molecular weight of 218.12 g/mol. Its IUPAC name is 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine.
Analyze 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine?
The IUPAC name of 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine (CID 82393363) is 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine.
What is the SMILES notation for 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine?
The canonical SMILES for 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine is Brc1scc2c1NCCC2.
What is the InChIKey of 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine?
The InChIKey is VWYCRZKLHMGLRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNS/c8-7-6-5(4-10-7)2-1-3-9-6/h4,9H,1-3H2.
What are the key properties of 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine?
7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine has a molecular weight of 218.12 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1,2,3,4-tetrahydrothieno[3,4-b]pyridine is sourced from PubChem (CID 82393363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).