About 7-butyl-5-fluoro-2,3-dihydro-1H-indole
7-butyl-5-fluoro-2,3-dihydro-1H-indole (PubChem CID 119082550) has the molecular formula C12H16FN
and a molecular weight of 193.26 g/mol. Its IUPAC name is 7-butyl-5-fluoro-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 7-butyl-5-fluoro-2,3-dihydro-1H-indole |
| PubChem CID | 119082550 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 7-butyl-5-fluoro-2,3-dihydro-1H-indole |
| SMILES | CCCCc1cc(F)cc2c1NCC2 |
| InChI | InChI=1S/C12H16FN/c1-2-3-4-9-7-11(13)8-10-5-6-14-12(9)10/h7-8,14H,2-6H2,1H3 |
| InChIKey | AFUKFCQCVHRPFA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-butyl-5-fluoro-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butyl-5-fluoro-2,3-dihydro-1H-indole?
The IUPAC name of 7-butyl-5-fluoro-2,3-dihydro-1H-indole (CID 119082550) is 7-butyl-5-fluoro-2,3-dihydro-1H-indole.
What is the SMILES notation for 7-butyl-5-fluoro-2,3-dihydro-1H-indole?
The canonical SMILES for 7-butyl-5-fluoro-2,3-dihydro-1H-indole is CCCCc1cc(F)cc2c1NCC2.
What is the InChIKey of 7-butyl-5-fluoro-2,3-dihydro-1H-indole?
The InChIKey is AFUKFCQCVHRPFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FN/c1-2-3-4-9-7-11(13)8-10-5-6-14-12(9)10/h7-8,14H,2-6H2,1H3.
What are the key properties of 7-butyl-5-fluoro-2,3-dihydro-1H-indole?
7-butyl-5-fluoro-2,3-dihydro-1H-indole has a molecular weight of 193.26 g/mol, XLogP of 3.14, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butyl-5-fluoro-2,3-dihydro-1H-indole is sourced from PubChem (CID 119082550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).