C12H16FN — CID 119082550
7-butyl-5-fluoro-2,3-dihydro-1H-indole (PubChem CID 119082550) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is 7-butyl-5-fluoro-2,3-dihydro-1H-indole.
| Compound Name | 7-butyl-5-fluoro-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 119082550 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 7-butyl-5-fluoro-2,3-dihydro-1H-indole |
| SMILES | CCCCc1cc(F)cc2c1NCC2 |
| InChI | InChI=1S/C12H16FN/c1-2-3-4-9-7-11(13)8-10-5-6-14-12(9)10/h7-8,14H,2-6H2,1H3 |
| InChIKey | AFUKFCQCVHRPFA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |