C16H27N — CID 142198128
6-butyl-2,3,4,5-tetrahydro-1H-3-benzazepine;ethane (PubChem CID 142198128) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 6-butyl-2,3,4,5-tetrahydro-1H-3-benzazepine;ethane.
| Compound Name | 6-butyl-2,3,4,5-tetrahydro-1H-3-benzazepine;ethane |
|---|---|
| PubChem CID | 142198128 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 6-butyl-2,3,4,5-tetrahydro-1H-3-benzazepine;ethane |
| SMILES | CC.CCCCc1cccc2c1CCNCC2 |
| InChI | InChI=1S/C14H21N.C2H6/c1-2-3-5-12-6-4-7-13-8-10-15-11-9-14(12)13;1-2/h4,6-7,15H,2-3,5,8-11H2,1H3;1-2H3 |
| InChIKey | WKSQKCFDJWMZLJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |