About (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride
(2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride (PubChem CID 46864780) has the molecular formula C15H24ClNO
and a molecular weight of 269.82 g/mol. Its IUPAC name is (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride.
Molecular Properties
| Compound Name | (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride |
| PubChem CID | 46864780 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride |
| SMILES | CCCCc1cccc2c1CCC(N)(CO)C2.Cl |
| InChI | InChI=1S/C15H23NO.ClH/c1-2-3-5-12-6-4-7-13-10-15(16,11-17)9-8-14(12)13;/h4,6-7,17H,2-3,5,8-11,16H2,1H3;1H |
| InChIKey | WGFAVPUVNKEMIH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride?
The IUPAC name of (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride (CID 46864780) is (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride.
What is the SMILES notation for (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride?
The canonical SMILES for (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride is CCCCc1cccc2c1CCC(N)(CO)C2.Cl.
What is the InChIKey of (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride?
The InChIKey is WGFAVPUVNKEMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO.ClH/c1-2-3-5-12-6-4-7-13-10-15(16,11-17)9-8-14(12)13;/h4,6-7,17H,2-3,5,8-11,16H2,1H3;1H.
What are the key properties of (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride?
(2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride has a molecular weight of 269.82 g/mol, XLogP of 2.63, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-5-butyl-3,4-dihydro-1H-naphthalen-2-yl)methanol;hydrochloride is sourced from PubChem (CID 46864780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).