C10H11Br — CID 170559962
2-(2-bromoethyl)bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 170559962) has the molecular formula C10H11Br and a molecular weight of 211.10 g/mol. Its IUPAC name is 2-(2-bromoethyl)bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 2-(2-bromoethyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 170559962 |
| Molecular Formula | C10H11Br |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 2-(2-bromoethyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | BrCCc1cccc2c1CC2 |
| InChI | InChI=1S/C10H11Br/c11-7-6-9-3-1-2-8-4-5-10(8)9/h1-3H,4-7H2 |
| InChIKey | XRNQAPUHZUJYOT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|