About 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+)
1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+) (PubChem CID 58598683) has the molecular formula C13H19FU3
and a molecular weight of 908.38 g/mol. Its IUPAC name is 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+).
Molecular Properties
| Compound Name | 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+) |
| PubChem CID | 58598683 |
| Molecular Formula | C13H19FU3 |
| Molecular Weight | 908.38 g/mol |
| Exact Mass | 908.30 |
| IUPAC Name | 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+) |
| SMILES | [CH2-]Cc1cc(F)ccc1CCCC.[CH3-].[U+2].[U].[U] |
| InChI | InChI=1S/C12H16F.CH3.3U/c1-3-5-6-11-7-8-12(13)9-10(11)4-2;;;;/h7-9H,2-6H2,1H3;1H3;;;/q2*-1;;;+2 |
| InChIKey | ZXQCXYFWHHJKQC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 908.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+)?
The IUPAC name of 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+) (CID 58598683) is 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+).
What is the SMILES notation for 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+)?
The canonical SMILES for 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+) is [CH2-]Cc1cc(F)ccc1CCCC.[CH3-].[U+2].[U].[U].
What is the InChIKey of 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+)?
The InChIKey is ZXQCXYFWHHJKQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F.CH3.3U/c1-3-5-6-11-7-8-12(13)9-10(11)4-2;;;;/h7-9H,2-6H2,1H3;1H3;;;/q2*-1;;;+2.
What are the key properties of 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+)?
1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+) has a molecular weight of 908.38 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-ethyl-4-fluorobenzene;carbanide;uranium;uranium(2+) is sourced from PubChem (CID 58598683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).