About N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide
N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide (PubChem CID 112537380) has the molecular formula C17H16BrN3O2
and a molecular weight of 374.24 g/mol. Its IUPAC name is N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide.
Molecular Properties
| Compound Name | N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide |
| PubChem CID | 112537380 |
| Molecular Formula | C17H16BrN3O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide |
| SMILES | CC(=O)N(C(=O)Cc1ccccn1)c1cc(Br)cc2c1NCC2 |
| InChI | InChI=1S/C17H16BrN3O2/c1-11(22)21(16(23)10-14-4-2-3-6-19-14)15-9-13(18)8-12-5-7-20-17(12)15/h2-4,6,8-9,20H,5,7,10H2,1H3 |
| InChIKey | JFWQVJILRJLYOU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide?
The IUPAC name of N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide (CID 112537380) is N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide.
What is the SMILES notation for N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide?
The canonical SMILES for N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide is CC(=O)N(C(=O)Cc1ccccn1)c1cc(Br)cc2c1NCC2.
What is the InChIKey of N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide?
The InChIKey is JFWQVJILRJLYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrN3O2/c1-11(22)21(16(23)10-14-4-2-3-6-19-14)15-9-13(18)8-12-5-7-20-17(12)15/h2-4,6,8-9,20H,5,7,10H2,1H3.
What are the key properties of N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide?
N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide has a molecular weight of 374.24 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N-(5-bromo-2,3-dihydro-1H-indol-7-yl)-2-pyridin-2-ylacetamide is sourced from PubChem (CID 112537380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).